C27H26FN3O — CID 3611317
1-[(4-benzylpiperidin-1-yl)methyl]-3-(3-fluorophenyl)iminoindol-2-one (PubChem CID 3611317) has the molecular formula C27H26FN3O and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3-fluorophenyl)iminoindol-2-one.
| Compound Name | 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3-fluorophenyl)iminoindol-2-one |
|---|---|
| PubChem CID | 3611317 |
| Molecular Formula | C27H26FN3O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3-fluorophenyl)iminoindol-2-one |
| SMILES | O=C1/C(=N\c2cccc(F)c2)c2ccccc2N1CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26FN3O/c28-22-9-6-10-23(18-22)29-26-24-11-4-5-12-25(24)31(27(26)32)19-30-15-13-21(14-16-30)17-20-7-2-1-3-8-20/h1-12,18,21H,13-17,19H2/b29-26- |
| InChIKey | AGIAWQKZZSPRQK-WCTVFOPTSA-N |
| XLogP | 5.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|