C29H31N3O — CID 17370028
1-[(4-benzylpiperidin-1-yl)methyl]-3-(3,5-dimethylphenyl)iminoindol-2-one (PubChem CID 17370028) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3,5-dimethylphenyl)iminoindol-2-one.
| Compound Name | 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3,5-dimethylphenyl)iminoindol-2-one |
|---|---|
| PubChem CID | 17370028 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[(4-benzylpiperidin-1-yl)methyl]-3-(3,5-dimethylphenyl)iminoindol-2-one |
| SMILES | Cc1cc(C)cc(/N=C2\C(=O)N(CN3CCC(Cc4ccccc4)CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C29H31N3O/c1-21-16-22(2)18-25(17-21)30-28-26-10-6-7-11-27(26)32(29(28)33)20-31-14-12-24(13-15-31)19-23-8-4-3-5-9-23/h3-11,16-18,24H,12-15,19-20H2,1-2H3/b30-28- |
| InChIKey | JROKBDYPFBQXLA-HYOGKJQXSA-N |
| XLogP | 5.68 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|