C23H26BrN3O — CID 17368140
3-(4-bromo-2,6-dimethylphenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one (PubChem CID 17368140) has the molecular formula C23H26BrN3O and a molecular weight of 440.39 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one |
|---|---|
| PubChem CID | 17368140 |
| Molecular Formula | C23H26BrN3O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one |
| SMILES | Cc1cc(Br)cc(C)c1/N=C1/C(=O)N(CN2CCC(C)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H26BrN3O/c1-15-8-10-26(11-9-15)14-27-20-7-5-4-6-19(20)22(23(27)28)25-21-16(2)12-18(24)13-17(21)3/h4-7,12-13,15H,8-11,14H2,1-3H3/b25-22+ |
| InChIKey | XVMMKGVONVJACC-YYDJUVGSSA-N |
| XLogP | 5.22 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|