C23H24BrN3O3 — CID 17380023
ethyl 1-[[3-(4-bromophenyl)imino-2-oxoindol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 17380023) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is ethyl 1-[[3-(4-bromophenyl)imino-2-oxoindol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-(4-bromophenyl)imino-2-oxoindol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17380023 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | ethyl 1-[[3-(4-bromophenyl)imino-2-oxoindol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CN2C(=O)/C(=N/c3ccc(Br)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H24BrN3O3/c1-2-30-23(29)16-11-13-26(14-12-16)15-27-20-6-4-3-5-19(20)21(22(27)28)25-18-9-7-17(24)8-10-18/h3-10,16H,2,11-15H2,1H3/b25-21+ |
| InChIKey | KPBMVYKPXXRGIT-NJNXFGOHSA-N |
| XLogP | 4.15 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|