C17H19FN2O4 — CID 9281963
ethyl 1-[(6-fluoro-2,3-dioxoindol-1-yl)methyl]piperidine-4-carboxylate (PubChem CID 9281963) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is ethyl 1-[(6-fluoro-2,3-dioxoindol-1-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(6-fluoro-2,3-dioxoindol-1-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9281963 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 1-[(6-fluoro-2,3-dioxoindol-1-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CN2C(=O)C(=O)c3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C17H19FN2O4/c1-2-24-17(23)11-5-7-19(8-6-11)10-20-14-9-12(18)3-4-13(14)15(21)16(20)22/h3-4,9,11H,2,5-8,10H2,1H3 |
| InChIKey | PFFSVTVVOXWCKD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|