C15H17FN2O2 — CID 171316298
ethyl 1-(2-cyano-5-fluorophenyl)piperidine-4-carboxylate (PubChem CID 171316298) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is ethyl 1-(2-cyano-5-fluorophenyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-cyano-5-fluorophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 171316298 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | ethyl 1-(2-cyano-5-fluorophenyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(F)ccc2C#N)CC1 |
| InChI | InChI=1S/C15H17FN2O2/c1-2-20-15(19)11-5-7-18(8-6-11)14-9-13(16)4-3-12(14)10-17/h3-4,9,11H,2,5-8H2,1H3 |
| InChIKey | DVONGNHGMKRGOS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |