C29H29N3O4 — CID 4211062
ethyl 1-[[2-oxo-3-(4-phenoxyphenyl)iminoindol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 4211062) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is ethyl 1-[[2-oxo-3-(4-phenoxyphenyl)iminoindol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[2-oxo-3-(4-phenoxyphenyl)iminoindol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4211062 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | ethyl 1-[[2-oxo-3-(4-phenoxyphenyl)iminoindol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CN2C(=O)/C(=N/c3ccc(Oc4ccccc4)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C29H29N3O4/c1-2-35-29(34)21-16-18-31(19-17-21)20-32-26-11-7-6-10-25(26)27(28(32)33)30-22-12-14-24(15-13-22)36-23-8-4-3-5-9-23/h3-15,21H,2,16-20H2,1H3/b30-27+ |
| InChIKey | KINJFZPPUVTMEK-KDJFERLWSA-N |
| XLogP | 5.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|