C26H21F3N2O2 — CID 143273663
1-[4-hydroxy-3-[(2-methylcyclopropyl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 143273663) has the molecular formula C26H21F3N2O2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-[4-hydroxy-3-[(2-methylcyclopropyl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[4-hydroxy-3-[(2-methylcyclopropyl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 143273663 |
| Molecular Formula | C26H21F3N2O2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[4-hydroxy-3-[(2-methylcyclopropyl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CC1CC1Cc1cc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)ccc1O |
| InChI | InChI=1S/C26H21F3N2O2/c1-15-11-16(15)12-17-13-20(9-10-23(17)32)31-22-8-3-2-7-21(22)24(25(31)33)30-19-6-4-5-18(14-19)26(27,28)29/h2-10,13-16,32H,11-12H2,1H3/b30-24+ |
| InChIKey | PGBPKFUVZQYVPI-BGABXYSRSA-N |
| XLogP | 6.41 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|