C28H28F3N3O3 — CID 11677898
1-[3-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 11677898) has the molecular formula C28H28F3N3O3 and a molecular weight of 511.54 g/mol. Its IUPAC name is 1-[3-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[3-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 11677898 |
| Molecular Formula | C28H28F3N3O3 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 1-[3-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CCN(CC)CC(O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C28H28F3N3O3/c1-3-33(4-2)17-22(35)18-37-23-12-8-11-21(16-23)34-25-14-6-5-13-24(25)26(27(34)36)32-20-10-7-9-19(15-20)28(29,30)31/h5-16,22,35H,3-4,17-18H2,1-2H3/b32-26+ |
| InChIKey | FDXFYSXCGJORLT-HMZBKAONSA-N |
| XLogP | 5.59 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|