C21H13F3N2O3 — CID 135464293
1-(3,4-dihydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 135464293) has the molecular formula C21H13F3N2O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 135464293 |
| Molecular Formula | C21H13F3N2O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H13F3N2O3/c22-21(23,24)12-4-3-5-13(10-12)25-19-15-6-1-2-7-16(15)26(20(19)29)14-8-9-17(27)18(28)11-14/h1-11,27-28H/b25-19+ |
| InChIKey | YKOUBHBFNSLCCI-NCELDCMTSA-N |
| XLogP | 4.92 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|