C30H32F3N3O2 — CID 58686011
1-[4-[3-[ethyl(propan-2-yl)amino]-2-methylpropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 58686011) has the molecular formula C30H32F3N3O2 and a molecular weight of 523.60 g/mol. Its IUPAC name is 1-[4-[3-[ethyl(propan-2-yl)amino]-2-methylpropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[4-[3-[ethyl(propan-2-yl)amino]-2-methylpropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 58686011 |
| Molecular Formula | C30H32F3N3O2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 1-[4-[3-[ethyl(propan-2-yl)amino]-2-methylpropoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CCN(CC(C)COc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1)C(C)C |
| InChI | InChI=1S/C30H32F3N3O2/c1-5-35(20(2)3)18-21(4)19-38-25-15-13-24(14-16-25)36-27-12-7-6-11-26(27)28(29(36)37)34-23-10-8-9-22(17-23)30(31,32)33/h6-17,20-21H,5,18-19H2,1-4H3/b34-28+ |
| InChIKey | UREIQZYNRDLGLQ-CDSHQWRTSA-N |
| XLogP | 7.25 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|