C17H21F3N2S — CID 170864305
1-methyl-4-[3-[5-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]piperazine (PubChem CID 170864305) has the molecular formula C17H21F3N2S and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-methyl-4-[3-[5-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]piperazine.
| Compound Name | 1-methyl-4-[3-[5-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]piperazine |
|---|---|
| PubChem CID | 170864305 |
| Molecular Formula | C17H21F3N2S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-methyl-4-[3-[5-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]piperazine |
| SMILES | CN1CCN(CCCc2cc3cc(C(F)(F)F)ccc3s2)CC1 |
| InChI | InChI=1S/C17H21F3N2S/c1-21-7-9-22(10-8-21)6-2-3-15-12-13-11-14(17(18,19)20)4-5-16(13)23-15/h4-5,11-12H,2-3,6-10H2,1H3 |
| InChIKey | JICZOLYYBVPVJB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |