C20H15Cl2N3S2 — CID 23904895
N-(3,4-dichlorophenyl)-3-(2-pyridin-2-ylethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23904895) has the molecular formula C20H15Cl2N3S2 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(2-pyridin-2-ylethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dichlorophenyl)-3-(2-pyridin-2-ylethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23904895 |
| Molecular Formula | C20H15Cl2N3S2 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(2-pyridin-2-ylethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | Clc1ccc(/N=c2\scc(-c3cccs3)n2CCc2ccccn2)cc1Cl |
| InChI | InChI=1S/C20H15Cl2N3S2/c21-16-7-6-15(12-17(16)22)24-20-25(10-8-14-4-1-2-9-23-14)18(13-27-20)19-5-3-11-26-19/h1-7,9,11-13H,8,10H2/b24-20- |
| InChIKey | JRAPQHRUJYEHIY-GFMRDNFCSA-N |
| XLogP | 6.45 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|