C22H17BrFN3S — CID 23769515
4-(2-bromophenyl)-N-(4-fluorophenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (PubChem CID 23769515) has the molecular formula C22H17BrFN3S and a molecular weight of 454.37 g/mol. Its IUPAC name is 4-(2-bromophenyl)-N-(4-fluorophenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2-bromophenyl)-N-(4-fluorophenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23769515 |
| Molecular Formula | C22H17BrFN3S |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 4-(2-bromophenyl)-N-(4-fluorophenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccccc3Br)n2CCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H17BrFN3S/c23-20-7-2-1-6-19(20)21-15-28-22(26-18-10-8-16(24)9-11-18)27(21)14-12-17-5-3-4-13-25-17/h1-11,13,15H,12,14H2/b26-22- |
| InChIKey | LNTUTXHVEZIONZ-ROMGYVFFSA-N |
| XLogP | 5.99 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|