C24H21F2N3O2S — CID 23735822
N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (PubChem CID 23735822) has the molecular formula C24H21F2N3O2S and a molecular weight of 453.51 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23735822 |
| Molecular Formula | C24H21F2N3O2S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(F)cc3F)n2CCc2ccccn2)c1 |
| InChI | InChI=1S/C24H21F2N3O2S/c1-30-18-7-9-23(31-2)19(14-18)22-15-32-24(28-21-8-6-16(25)13-20(21)26)29(22)12-10-17-5-3-4-11-27-17/h3-9,11,13-15H,10,12H2,1-2H3/b28-24- |
| InChIKey | UBJRCDGLBCLODE-COOPMVRXSA-N |
| XLogP | 5.38 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|