C25H21N3O2S — CID 23934250
4-(1-benzofuran-2-yl)-N-(3-methoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (PubChem CID 23934250) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-(3-methoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-N-(3-methoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23934250 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-(3-methoxyphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| SMILES | COc1cccc(/N=c2\scc(-c3cc4ccccc4o3)n2CCc2ccccn2)c1 |
| InChI | InChI=1S/C25H21N3O2S/c1-29-21-10-6-9-20(16-21)27-25-28(14-12-19-8-4-5-13-26-19)22(17-31-25)24-15-18-7-2-3-11-23(18)30-24/h2-11,13,15-17H,12,14H2,1H3/b27-25- |
| InChIKey | VUYBKNGEEULQAG-RFBIWTDZSA-N |
| XLogP | 5.84 |
| TPSA | 52.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|