C22H15N5OS — CID 23940312
4-(1-benzofuran-2-yl)-N-pyridin-3-yl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23940312) has the molecular formula C22H15N5OS and a molecular weight of 397.46 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-pyridin-3-yl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-N-pyridin-3-yl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23940312 |
| Molecular Formula | C22H15N5OS |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-pyridin-3-yl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C(=Nn1c(-c2cc3ccccc3o2)cs/c1=N\c1cccnc1)c1ccccn1 |
| InChI | InChI=1S/C22H15N5OS/c1-2-9-20-16(6-1)12-21(28-20)19-15-29-22(26-18-8-5-10-23-13-18)27(19)25-14-17-7-3-4-11-24-17/h1-15H/b25-14?,26-22- |
| InChIKey | ZANZEIVKAGDMEK-PJNVBFLLSA-N |
| XLogP | 4.87 |
| TPSA | 68.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|