C23H14ClN5O3S — CID 23883507
4-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23883507) has the molecular formula C23H14ClN5O3S and a molecular weight of 475.92 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23883507 |
| Molecular Formula | C23H14ClN5O3S |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cc(C=Nn2c(-c3cc4ccccc4o3)cs/c2=N\c2cccnc2)ccc1Cl |
| InChI | InChI=1S/C23H14ClN5O3S/c24-18-8-7-15(10-19(18)29(30)31)12-26-28-20(22-11-16-4-1-2-6-21(16)32-22)14-33-23(28)27-17-5-3-9-25-13-17/h1-14H/b26-12?,27-23- |
| InChIKey | OJPIDRIAVLWJFX-SECGXMAXSA-N |
| XLogP | 6.03 |
| TPSA | 98.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|