C28H23N5O4S — CID 23879774
4-(1-benzofuran-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23879774) has the molecular formula C28H23N5O4S and a molecular weight of 525.59 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23879774 |
| Molecular Formula | C28H23N5O4S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2cc3ccccc3o2)n1N=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H23N5O4S/c34-33(35)24-7-3-2-6-23(24)30-28-32(25(19-38-28)27-17-21-5-1-4-8-26(21)37-27)29-18-20-9-11-22(12-10-20)31-13-15-36-16-14-31/h1-12,17-19H,13-16H2/b29-18?,30-28- |
| InChIKey | QJQBEICEWWIOET-DNAPFHOSSA-N |
| XLogP | 5.82 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|