C24H21FN4O2S — CID 23822766
N-(4-fluorophenyl)-4-(furan-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23822766) has the molecular formula C24H21FN4O2S and a molecular weight of 448.52 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(furan-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-(4-fluorophenyl)-4-(furan-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23822766 |
| Molecular Formula | C24H21FN4O2S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(4-fluorophenyl)-4-(furan-2-yl)-3-[(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccco3)n2N=Cc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H21FN4O2S/c25-19-5-7-20(8-6-19)27-24-29(22(17-32-24)23-2-1-13-31-23)26-16-18-3-9-21(10-4-18)28-11-14-30-15-12-28/h1-10,13,16-17H,11-12,14-15H2/b26-16?,27-24- |
| InChIKey | QTNZXHSJYRTALE-PDQXPSKDSA-N |
| XLogP | 4.90 |
| TPSA | 55.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|