C20H12Cl2FN3OS — CID 23992503
4-(2,5-dichlorophenyl)-N-(4-fluorophenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23992503) has the molecular formula C20H12Cl2FN3OS and a molecular weight of 432.31 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-N-(4-fluorophenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dichlorophenyl)-N-(4-fluorophenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23992503 |
| Molecular Formula | C20H12Cl2FN3OS |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-N-(4-fluorophenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3cc(Cl)ccc3Cl)n2N=Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H12Cl2FN3OS/c21-13-3-8-18(22)17(10-13)19-12-28-20(25-15-6-4-14(23)5-7-15)26(19)24-11-16-2-1-9-27-16/h1-12H/b24-11?,25-20- |
| InChIKey | URYHKEIJPTXCAV-OGNRGYFLSA-N |
| XLogP | 6.37 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|