C22H15Cl2FN2S — CID 2322788
4-(2-chlorophenyl)-3-[(4-chlorophenyl)methyl]-N-(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 2322788) has the molecular formula C22H15Cl2FN2S and a molecular weight of 429.35 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-[(4-chlorophenyl)methyl]-N-(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2-chlorophenyl)-3-[(4-chlorophenyl)methyl]-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2322788 |
| Molecular Formula | C22H15Cl2FN2S |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-(2-chlorophenyl)-3-[(4-chlorophenyl)methyl]-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccccc3Cl)n2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H15Cl2FN2S/c23-16-7-5-15(6-8-16)13-27-21(19-3-1-2-4-20(19)24)14-28-22(27)26-18-11-9-17(25)10-12-18/h1-12,14H,13H2/b26-22- |
| InChIKey | AKBZGNFXWUWXDH-ROMGYVFFSA-N |
| XLogP | 6.94 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|