C19H17Cl2FN2OS — CID 5182240
4-(2,4-dichlorophenyl)-N-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)-1,3-thiazol-2-imine (PubChem CID 5182240) has the molecular formula C19H17Cl2FN2OS and a molecular weight of 411.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5182240 |
| Molecular Formula | C19H17Cl2FN2OS |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(4-fluorophenyl)-3-(1-methoxypropan-2-yl)-1,3-thiazol-2-imine |
| SMILES | COCC(C)n1c(-c2ccc(Cl)cc2Cl)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17Cl2FN2OS/c1-12(10-25-2)24-18(16-8-3-13(20)9-17(16)21)11-26-19(24)23-15-6-4-14(22)5-7-15/h3-9,11-12H,10H2,1-2H3/b23-19- |
| InChIKey | FPAFYFCPWRAXIG-NMWGTECJSA-N |
| XLogP | 6.10 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|