C23H26Cl2N2S — CID 4174745
4-(2,4-dichlorophenyl)-3-(5-methylhexan-2-yl)-N-(2-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 4174745) has the molecular formula C23H26Cl2N2S and a molecular weight of 433.45 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-(5-methylhexan-2-yl)-N-(2-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dichlorophenyl)-3-(5-methylhexan-2-yl)-N-(2-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4174745 |
| Molecular Formula | C23H26Cl2N2S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-(5-methylhexan-2-yl)-N-(2-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccccc1/N=c1\scc(-c2ccc(Cl)cc2Cl)n1C(C)CCC(C)C |
| InChI | InChI=1S/C23H26Cl2N2S/c1-15(2)9-10-17(4)27-22(19-12-11-18(24)13-20(19)25)14-28-23(27)26-21-8-6-5-7-16(21)3/h5-8,11-15,17H,9-10H2,1-4H3/b26-23- |
| InChIKey | LRMUXOFKCSVCFN-RWEWTDSWSA-N |
| XLogP | 8.06 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|