C23H16Br2ClF3N2S — CID 90484915
4-(4-bromophenyl)-3-[(4-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine;hydrobromide (PubChem CID 90484915) has the molecular formula C23H16Br2ClF3N2S and a molecular weight of 604.72 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[(4-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 4-(4-bromophenyl)-3-[(4-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 90484915 |
| Molecular Formula | C23H16Br2ClF3N2S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 601.90 |
| IUPAC Name | 4-(4-bromophenyl)-3-[(4-chlorophenyl)methyl]-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.FC(F)(F)c1cccc(/N=c2\scc(-c3ccc(Br)cc3)n2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H15BrClF3N2S.BrH/c24-18-8-6-16(7-9-18)21-14-31-22(30(21)13-15-4-10-19(25)11-5-15)29-20-3-1-2-17(12-20)23(26,27)28;/h1-12,14H,13H2;1H/b29-22-; |
| InChIKey | CRTGWXOETLIYDG-RQSYFIJOSA-N |
| XLogP | 8.51 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|