C25H28BrF3N2OS — CID 90484922
3-[4-(4-cyclohexylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]propan-1-ol;hydrobromide (PubChem CID 90484922) has the molecular formula C25H28BrF3N2OS and a molecular weight of 541.48 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]propan-1-ol;hydrobromide.
| Compound Name | 3-[4-(4-cyclohexylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]propan-1-ol;hydrobromide |
|---|---|
| PubChem CID | 90484922 |
| Molecular Formula | C25H28BrF3N2OS |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 3-[4-(4-cyclohexylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]propan-1-ol;hydrobromide |
| SMILES | Br.OCCCn1c(-c2ccc(C3CCCCC3)cc2)cs/c1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N2OS.BrH/c26-25(27,28)21-8-4-9-22(16-21)29-24-30(14-5-15-31)23(17-32-24)20-12-10-19(11-13-20)18-6-2-1-3-7-18;/h4,8-13,16-18,31H,1-3,5-7,14-15H2;1H/b29-24-; |
| InChIKey | WLFYHMMQRJGVSW-PSVMXRHTSA-N |
| XLogP | 7.48 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|