C19H17F3N2S — CID 5170510
3-ethyl-4-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine (PubChem CID 5170510) has the molecular formula C19H17F3N2S and a molecular weight of 362.42 g/mol. Its IUPAC name is 3-ethyl-4-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine.
| Compound Name | 3-ethyl-4-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5170510 |
| Molecular Formula | C19H17F3N2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-ethyl-4-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-imine |
| SMILES | CCn1c(-c2ccc(C)cc2)cs/c1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2S/c1-3-24-17(14-9-7-13(2)8-10-14)12-25-18(24)23-16-6-4-5-15(11-16)19(20,21)22/h4-12H,3H2,1-2H3/b23-18- |
| InChIKey | VPWJWCCRKORTCG-NKFKGCMQSA-N |
| XLogP | 5.80 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|