C23H15Cl2F3N2S2 — CID 2467414
3-[(2,4-dichlorophenyl)methyl]-N-[4-(difluoromethylsulfanyl)phenyl]-4-(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 2467414) has the molecular formula C23H15Cl2F3N2S2 and a molecular weight of 511.42 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-N-[4-(difluoromethylsulfanyl)phenyl]-4-(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-N-[4-(difluoromethylsulfanyl)phenyl]-4-(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2467414 |
| Molecular Formula | C23H15Cl2F3N2S2 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-N-[4-(difluoromethylsulfanyl)phenyl]-4-(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(-c2cs/c(=N\c3ccc(SC(F)F)cc3)n2Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H15Cl2F3N2S2/c24-16-4-1-15(20(25)11-16)12-30-21(14-2-5-17(26)6-3-14)13-31-23(30)29-18-7-9-19(10-8-18)32-22(27)28/h1-11,13,22H,12H2/b29-23- |
| InChIKey | XAAFRZFRBDGLDG-FAJYDZGRSA-N |
| XLogP | 8.26 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|