C21H17FN2OS — CID 23856464
N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 23856464) has the molecular formula C21H17FN2OS and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23856464 |
| Molecular Formula | C21H17FN2OS |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(4-fluorophenyl)-3-(furan-2-ylmethyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccc(F)cc3)n2Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H17FN2OS/c1-15-4-6-16(7-5-15)20-14-26-21(23-18-10-8-17(22)9-11-18)24(20)13-19-3-2-12-25-19/h2-12,14H,13H2,1H3/b23-21- |
| InChIKey | DDBKYTAMBJLGRR-LNVKXUELSA-N |
| XLogP | 5.54 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|