C15H13ClN2OS — CID 23913461
N-(4-chlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine (PubChem CID 23913461) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine.
| Compound Name | N-(4-chlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23913461 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(4-chlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(Cl)cc2)n1Cc1ccco1 |
| InChI | InChI=1S/C15H13ClN2OS/c1-11-10-20-15(17-13-6-4-12(16)5-7-13)18(11)9-14-3-2-8-19-14/h2-8,10H,9H2,1H3/b17-15- |
| InChIKey | FLPGOUHPKPGDOY-ICFOKQHNSA-N |
| XLogP | 4.39 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|