C15H12Cl2N2OS — CID 23876718
N-(3,4-dichlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine (PubChem CID 23876718) has the molecular formula C15H12Cl2N2OS and a molecular weight of 339.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dichlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23876718 |
| Molecular Formula | C15H12Cl2N2OS |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(furan-2-ylmethyl)-4-methyl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(Cl)c(Cl)c2)n1Cc1ccco1 |
| InChI | InChI=1S/C15H12Cl2N2OS/c1-10-9-21-15(19(10)8-12-3-2-6-20-12)18-11-4-5-13(16)14(17)7-11/h2-7,9H,8H2,1H3/b18-15- |
| InChIKey | MCVYJTXFHJRNLY-SDXDJHTJSA-N |
| XLogP | 5.04 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|