C16H14Cl2N2OS2 — CID 23911708
N-(3,4-dichlorophenyl)-3-(2-methoxyethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23911708) has the molecular formula C16H14Cl2N2OS2 and a molecular weight of 385.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(2-methoxyethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dichlorophenyl)-3-(2-methoxyethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23911708 |
| Molecular Formula | C16H14Cl2N2OS2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(2-methoxyethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2cccs2)cs/c1=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2OS2/c1-21-7-6-20-14(15-3-2-8-22-15)10-23-16(20)19-11-4-5-12(17)13(18)9-11/h2-5,8-10H,6-7H2,1H3/b19-16- |
| InChIKey | REQFCZLAAQCVAS-MNDPQUGUSA-N |
| XLogP | 5.46 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|