C18H20N2O2S — CID 23799456
N-(3,5-dimethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 23799456) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(3,5-dimethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23799456 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2ccco2)cs/c1=N\c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13-9-14(2)11-15(10-13)19-18-20(6-8-21-3)16(12-23-18)17-5-4-7-22-17/h4-5,7,9-12H,6,8H2,1-3H3/b19-18- |
| InChIKey | KSOMDENUCJFCCN-HNENSFHCSA-N |
| XLogP | 4.31 |
| TPSA | 39.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|