C19H22N2OS — CID 23829109
3-butyl-N-(3,4-dimethylphenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine (PubChem CID 23829109) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 3-butyl-N-(3,4-dimethylphenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine.
| Compound Name | 3-butyl-N-(3,4-dimethylphenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23829109 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-butyl-N-(3,4-dimethylphenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine |
| SMILES | CCCCn1c(-c2ccco2)cs/c1=N\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H22N2OS/c1-4-5-10-21-17(18-7-6-11-22-18)13-23-19(21)20-16-9-8-14(2)15(3)12-16/h6-9,11-13H,4-5,10H2,1-3H3/b20-19- |
| InChIKey | BWRXKPPZUZXMST-VXPUYCOJSA-N |
| XLogP | 5.46 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|