C20H24N2O2S — CID 23790036
N-(2,6-diethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 23790036) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,6-diethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23790036 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-4-(furan-2-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | CCc1cccc(CC)c1/N=c1\scc(-c2ccco2)n1CCOC |
| InChI | InChI=1S/C20H24N2O2S/c1-4-15-8-6-9-16(5-2)19(15)21-20-22(11-13-23-3)17(14-25-20)18-10-7-12-24-18/h6-10,12,14H,4-5,11,13H2,1-3H3/b21-20- |
| InChIKey | VPHVCIBOKMVNIZ-MRCUWXFGSA-N |
| XLogP | 4.81 |
| TPSA | 39.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|