C21H15ClN2O3S — CID 23992842
3-(1,3-benzodioxol-5-ylmethyl)-N-(3-chlorophenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine (PubChem CID 23992842) has the molecular formula C21H15ClN2O3S and a molecular weight of 410.88 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-N-(3-chlorophenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3-chlorophenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23992842 |
| Molecular Formula | C21H15ClN2O3S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3-chlorophenyl)-4-(furan-2-yl)-1,3-thiazol-2-imine |
| SMILES | Clc1cccc(/N=c2\scc(-c3ccco3)n2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C21H15ClN2O3S/c22-15-3-1-4-16(10-15)23-21-24(17(12-28-21)18-5-2-8-25-18)11-14-6-7-19-20(9-14)27-13-26-19/h1-10,12H,11,13H2/b23-21- |
| InChIKey | VLYVXDUTNJPZLJ-LNVKXUELSA-N |
| XLogP | 5.47 |
| TPSA | 48.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|