C23H18BrN3O4S — CID 90484802
3-(1,3-benzodioxol-5-ylmethyl)-4-(4-nitrophenyl)-N-phenyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 90484802) has the molecular formula C23H18BrN3O4S and a molecular weight of 512.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-nitrophenyl)-N-phenyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-nitrophenyl)-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 90484802 |
| Molecular Formula | C23H18BrN3O4S |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-nitrophenyl)-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1ccc(-c2cs/c(=N\c3ccccc3)n2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H17N3O4S.BrH/c27-26(28)19-9-7-17(8-10-19)20-14-31-23(24-18-4-2-1-3-5-18)25(20)13-16-6-11-21-22(12-16)30-15-29-21;/h1-12,14H,13,15H2;1H/b24-23-; |
| InChIKey | KVIDTHAZHWICAL-DCXSSQDFSA-N |
| XLogP | 5.71 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|