C25H21N3O4S — CID 23995691
3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dimethylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23995691) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dimethylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dimethylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23995691 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(3,5-dimethylphenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cc(C)cc(/N=c2\scc(-c3cccc([N+](=O)[O-])c3)n2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C25H21N3O4S/c1-16-8-17(2)10-20(9-16)26-25-27(13-18-6-7-23-24(11-18)32-15-31-23)22(14-33-25)19-4-3-5-21(12-19)28(29)30/h3-12,14H,13,15H2,1-2H3/b26-25- |
| InChIKey | XHBKEUUCDOAETA-QPLCGJKRSA-N |
| XLogP | 5.75 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|