C20H17BrN3O3S- — CID 21203642
1-[4-[[4-(3-nitrophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]phenyl]ethanone bromide (PubChem CID 21203642) has the molecular formula C20H17BrN3O3S- and a molecular weight of 459.35 g/mol. Its IUPAC name is 1-[4-[[4-(3-nitrophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]phenyl]ethanone bromide.
| Compound Name | 1-[4-[[4-(3-nitrophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]phenyl]ethanone bromide |
|---|---|
| PubChem CID | 21203642 |
| Molecular Formula | C20H17BrN3O3S- |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 1-[4-[[4-(3-nitrophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]phenyl]ethanone bromide |
| SMILES | C=CCn1c(-c2cccc([N+](=O)[O-])c2)cs/c1=N\c1ccc(C(C)=O)cc1.[Br-] |
| InChI | InChI=1S/C20H17N3O3S.BrH/c1-3-11-22-19(16-5-4-6-18(12-16)23(25)26)13-27-20(22)21-17-9-7-15(8-10-17)14(2)24;/h3-10,12-13H,1,11H2,2H3;1H/p-1/b21-20-; |
| InChIKey | YUTFLGAKMCJLGW-CFRCJOIHSA-M |
| XLogP | 1.75 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|