C20H17N5O6S — CID 23829130
3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-(3-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23829130) has the molecular formula C20H17N5O6S and a molecular weight of 455.45 g/mol. Its IUPAC name is 3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-(3-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-(3-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23829130 |
| Molecular Formula | C20H17N5O6S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-(3-nitrophenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2cccc([N+](=O)[O-])c2)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C20H17N5O6S/c1-12(2)22-20-23(17(10-32-20)13-4-3-5-15(6-13)24(26)27)21-9-14-7-18-19(31-11-30-18)8-16(14)25(28)29/h3-10,12H,11H2,1-2H3/b21-9?,22-20- |
| InChIKey | IGCNSKNVTYDOMR-ITHRNTHISA-N |
| XLogP | 3.95 |
| TPSA | 134.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|