C23H14FN5O6S — CID 23995823
4-(4-fluorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23995823) has the molecular formula C23H14FN5O6S and a molecular weight of 507.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-fluorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23995823 |
| Molecular Formula | C23H14FN5O6S |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cc2c(cc1C=Nn1c(-c3ccc(F)cc3)cs/c1=N\c1ccccc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C23H14FN5O6S/c24-16-7-5-14(6-8-16)20-12-36-23(26-17-3-1-2-4-18(17)28(30)31)27(20)25-11-15-9-21-22(35-13-34-21)10-19(15)29(32)33/h1-12H,13H2/b25-11?,26-23- |
| InChIKey | HVUQGQOVNMLEBW-BFUNBBSWSA-N |
| XLogP | 5.02 |
| TPSA | 134.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|