C22H15ClN4O5S — CID 23988021
N-(3-chloro-2-methylphenyl)-4-(furan-2-yl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23988021) has the molecular formula C22H15ClN4O5S and a molecular weight of 482.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-(furan-2-yl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-(furan-2-yl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23988021 |
| Molecular Formula | C22H15ClN4O5S |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-(furan-2-yl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1c(Cl)cccc1/N=c1\scc(-c2ccco2)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C22H15ClN4O5S/c1-13-15(23)4-2-5-16(13)25-22-26(18(11-33-22)19-6-3-7-30-19)24-10-14-8-20-21(32-12-31-20)9-17(14)27(28)29/h2-11H,12H2,1H3/b24-10?,25-22- |
| InChIKey | BOSHVWTYJLIFBP-ILZDNCSGSA-N |
| XLogP | 5.52 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|