C20H16Cl2N4O4S — CID 23995230
4-(2,5-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23995230) has the molecular formula C20H16Cl2N4O4S and a molecular weight of 479.35 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23995230 |
| Molecular Formula | C20H16Cl2N4O4S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2cc(Cl)ccc2Cl)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C20H16Cl2N4O4S/c1-11(2)24-20-25(17(9-31-20)14-6-13(21)3-4-15(14)22)23-8-12-5-18-19(30-10-29-18)7-16(12)26(27)28/h3-9,11H,10H2,1-2H3/b23-8?,24-20- |
| InChIKey | KEVULTCVMLQKOK-ODAPYNPJSA-N |
| XLogP | 5.35 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|