C20H14Cl2N4O4S — CID 23905103
4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23905103) has the molecular formula C20H14Cl2N4O4S and a molecular weight of 477.33 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23905103 |
| Molecular Formula | C20H14Cl2N4O4S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(Cl)c(Cl)c2)n1N=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C20H14Cl2N4O4S/c1-2-5-23-20-25(17(10-31-20)12-3-4-14(21)15(22)6-12)24-9-13-7-18-19(30-11-29-18)8-16(13)26(27)28/h2-4,6-10H,1,5,11H2/b23-20-,24-9? |
| InChIKey | NBTHZOSIYBSQIB-QLZSLHJKSA-N |
| XLogP | 5.13 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|