C23H16BrN3O4S — CID 23829362
3-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23829362) has the molecular formula C23H16BrN3O4S and a molecular weight of 510.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23829362 |
| Molecular Formula | C23H16BrN3O4S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2ccc(Br)cc2)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H16BrN3O4S/c24-17-8-6-16(7-9-17)20-13-32-23(25-18-3-1-2-4-19(18)27(28)29)26(20)12-15-5-10-21-22(11-15)31-14-30-21/h1-11,13H,12,14H2/b25-23- |
| InChIKey | ILXHTDKBVFCISD-BZZOAKBMSA-N |
| XLogP | 5.90 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|