C24H16FN3O3S — CID 23911040
4-(1-benzofuran-2-yl)-3-[(4-fluorophenyl)methyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23911040) has the molecular formula C24H16FN3O3S and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-[(4-fluorophenyl)methyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-[(4-fluorophenyl)methyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23911040 |
| Molecular Formula | C24H16FN3O3S |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-[(4-fluorophenyl)methyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2cc3ccccc3o2)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H16FN3O3S/c25-18-11-9-16(10-12-18)14-27-21(23-13-17-5-1-4-8-22(17)31-23)15-32-24(27)26-19-6-2-3-7-20(19)28(29)30/h1-13,15H,14H2/b26-24- |
| InChIKey | BTGZDRQVWNAZHU-LCUIJRPUSA-N |
| XLogP | 6.29 |
| TPSA | 73.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|