C14H17N3O2S — CID 23741646
3-butyl-4-methyl-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23741646) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-butyl-4-methyl-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-butyl-4-methyl-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23741646 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-butyl-4-methyl-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | CCCCn1c(C)cs/c1=N\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O2S/c1-3-4-9-16-11(2)10-20-14(16)15-12-7-5-6-8-13(12)17(18)19/h5-8,10H,3-4,9H2,1-2H3/b15-14- |
| InChIKey | FVDNJWFAIOFPNH-PFONDFGASA-N |
| XLogP | 3.80 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|