C19H19N3O4S2 — CID 23935863
ethyl 4-[2-(2-nitrophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]butanoate (PubChem CID 23935863) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 4-[2-(2-nitrophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]butanoate.
| Compound Name | ethyl 4-[2-(2-nitrophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 23935863 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | ethyl 4-[2-(2-nitrophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c(-c2cccs2)cs/c1=N\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O4S2/c1-2-26-18(23)10-5-11-21-16(17-9-6-12-27-17)13-28-19(21)20-14-7-3-4-8-15(14)22(24)25/h3-4,6-9,12-13H,2,5,10-11H2,1H3/b20-19- |
| InChIKey | YNDJTCKPUVNZAF-VXPUYCOJSA-N |
| XLogP | 4.76 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|