C20H20FN3OS2 — CID 2418953
1-[3-[2-(2-fluorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one (PubChem CID 2418953) has the molecular formula C20H20FN3OS2 and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[3-[2-(2-fluorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-(2-fluorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 2418953 |
| Molecular Formula | C20H20FN3OS2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[3-[2-(2-fluorophenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCn1c(-c2cccs2)cs/c1=N\c1ccccc1F |
| InChI | InChI=1S/C20H20FN3OS2/c21-15-6-1-2-7-16(15)22-20-24(12-5-11-23-10-3-9-19(23)25)17(14-27-20)18-8-4-13-26-18/h1-2,4,6-8,13-14H,3,5,9-12H2/b22-20- |
| InChIKey | RZOAQGVGLYJGAP-XDOYNYLZSA-N |
| XLogP | 4.66 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|