C24H26BrN3OS — CID 23795975
1-[3-[4-(4-bromophenyl)-2-(2,6-dimethylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one (PubChem CID 23795975) has the molecular formula C24H26BrN3OS and a molecular weight of 484.46 g/mol. Its IUPAC name is 1-[3-[4-(4-bromophenyl)-2-(2,6-dimethylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-(4-bromophenyl)-2-(2,6-dimethylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23795975 |
| Molecular Formula | C24H26BrN3OS |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 1-[3-[4-(4-bromophenyl)-2-(2,6-dimethylphenyl)imino-1,3-thiazol-3-yl]propyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C)c1/N=c1\scc(-c2ccc(Br)cc2)n1CCCN1CCCC1=O |
| InChI | InChI=1S/C24H26BrN3OS/c1-17-6-3-7-18(2)23(17)26-24-28(15-5-14-27-13-4-8-22(27)29)21(16-30-24)19-9-11-20(25)12-10-19/h3,6-7,9-12,16H,4-5,8,13-15H2,1-2H3/b26-24- |
| InChIKey | VYEHPDCKYTZHNW-LCUIJRPUSA-N |
| XLogP | 5.84 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|